About 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver
3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver (PubChem CID 88760860) has the molecular formula C11H9AgFN2O2
and a molecular weight of 328.07 g/mol. Its IUPAC name is 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver.
Molecular Properties
| Compound Name | 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver |
| PubChem CID | 88760860 |
| Molecular Formula | C11H9AgFN2O2 |
| Molecular Weight | 328.07 g/mol |
| Exact Mass | 326.97 |
| IUPAC Name | 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver |
| SMILES | O=c1[nH]cc(F)c(=O)n1Cc1ccccc1.[Ag] |
| InChI | InChI=1S/C11H9FN2O2.Ag/c12-9-6-13-11(16)14(10(9)15)7-8-4-2-1-3-5-8;/h1-6H,7H2,(H,13,16); |
| InChIKey | QXVUTFQLBYPFRC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.07 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver?
The IUPAC name of 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver (CID 88760860) is 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver.
What is the SMILES notation for 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver?
The canonical SMILES for 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver is O=c1[nH]cc(F)c(=O)n1Cc1ccccc1.[Ag].
What is the InChIKey of 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver?
The InChIKey is QXVUTFQLBYPFRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2O2.Ag/c12-9-6-13-11(16)14(10(9)15)7-8-4-2-1-3-5-8;/h1-6H,7H2,(H,13,16);.
What are the key properties of 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver?
3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver has a molecular weight of 328.07 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-5-fluoro-1H-pyrimidine-2,4-dione;silver is sourced from PubChem (CID 88760860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).