About 21,22-dihydroporphyrin;2-methylpropane;zinc
21,22-dihydroporphyrin;2-methylpropane;zinc (PubChem CID 88761237) has the molecular formula C24H23N4Zn-
and a molecular weight of 432.87 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;2-methylpropane;zinc.
Molecular Properties
| Compound Name | 21,22-dihydroporphyrin;2-methylpropane;zinc |
| PubChem CID | 88761237 |
| Molecular Formula | C24H23N4Zn- |
| Molecular Weight | 432.87 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 21,22-dihydroporphyrin;2-methylpropane;zinc |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.C[C-](C)C.[Zn] |
| InChI | InChI=1S/C20H14N4.C4H9.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-4(2)3;/h1-12,21-22H;1-3H3;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | YKUSFTYURMNHHO-IAULSPAKSA-N |
| XLogP | 6.27 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.87 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 21,22-dihydroporphyrin;2-methylpropane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 21,22-dihydroporphyrin;2-methylpropane;zinc?
The IUPAC name of 21,22-dihydroporphyrin;2-methylpropane;zinc (CID 88761237) is 21,22-dihydroporphyrin;2-methylpropane;zinc.
What is the SMILES notation for 21,22-dihydroporphyrin;2-methylpropane;zinc?
The canonical SMILES for 21,22-dihydroporphyrin;2-methylpropane;zinc is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.C[C-](C)C.[Zn].
What is the InChIKey of 21,22-dihydroporphyrin;2-methylpropane;zinc?
The InChIKey is YKUSFTYURMNHHO-IAULSPAKSA-N. The full InChI is InChI=1S/C20H14N4.C4H9.Zn/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;1-4(2)3;/h1-12,21-22H;1-3H3;/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;.
What are the key properties of 21,22-dihydroporphyrin;2-methylpropane;zinc?
21,22-dihydroporphyrin;2-methylpropane;zinc has a molecular weight of 432.87 g/mol, XLogP of 6.27, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 21,22-dihydroporphyrin;2-methylpropane;zinc is sourced from PubChem (CID 88761237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).