C17H23F6N — CID 88761284
5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,3-dipentylpyrrole (PubChem CID 88761284) has the molecular formula C17H23F6N and a molecular weight of 355.37 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,3-dipentylpyrrole.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,3-dipentylpyrrole |
|---|---|
| PubChem CID | 88761284 |
| Molecular Formula | C17H23F6N |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-2,3-dipentylpyrrole |
| SMILES | CCCCCC1=CC(=C(C(F)(F)F)C(F)(F)F)N=C1CCCCC |
| InChI | InChI=1S/C17H23F6N/c1-3-5-7-9-12-11-14(24-13(12)10-8-6-4-2)15(16(18,19)20)17(21,22)23/h11H,3-10H2,1-2H3 |
| InChIKey | JDQFFIHYFBEHBT-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|