C27H39N3O6S3 — CID 88761927
O-[2-[3,5-bis(2-hex-5-enethioyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl] hex-5-enethioate (PubChem CID 88761927) has the molecular formula C27H39N3O6S3 and a molecular weight of 597.83 g/mol. Its IUPAC name is O-[2-[3,5-bis(2-hex-5-enethioyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl] hex-5-enethioate.
| Compound Name | O-[2-[3,5-bis(2-hex-5-enethioyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl] hex-5-enethioate |
|---|---|
| PubChem CID | 88761927 |
| Molecular Formula | C27H39N3O6S3 |
| Molecular Weight | 597.83 g/mol |
| Exact Mass | 597.20 |
| IUPAC Name | O-[2-[3,5-bis(2-hex-5-enethioyloxyethyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]ethyl] hex-5-enethioate |
| SMILES | C=CCCCC(=S)OCCn1c(=O)n(CCOC(=S)CCCC=C)c(=O)n(CCOC(=S)CCCC=C)c1=O |
| InChI | InChI=1S/C27H39N3O6S3/c1-4-7-10-13-22(37)34-19-16-28-25(31)29(17-20-35-23(38)14-11-8-5-2)27(33)30(26(28)32)18-21-36-24(39)15-12-9-6-3/h4-6H,1-3,7-21H2 |
| InChIKey | WHGWVRBVRMDUIQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.83 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|