About (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide
(E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide (PubChem CID 88762037) has the molecular formula C21H30N2O6
and a molecular weight of 406.48 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide.
Molecular Properties
| Compound Name | (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide |
| PubChem CID | 88762037 |
| Molecular Formula | C21H30N2O6 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide |
| SMILES | CCCCN(C(=O)c1ccccc1)[C@@H]1CN(CC)C[C@H]1O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H26N2O2.C4H4O4/c1-3-5-11-19(15-12-18(4-2)13-16(15)20)17(21)14-9-7-6-8-10-14;5-3(6)1-2-4(7)8/h6-10,15-16,20H,3-5,11-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,16-;/m1./s1 |
| InChIKey | SHNZSHRMJPVMST-GVNJZHQWSA-N |
| XLogP | 1.71 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide?
The IUPAC name of (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide (CID 88762037) is (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide.
What is the SMILES notation for (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide?
The canonical SMILES for (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide is CCCCN(C(=O)c1ccccc1)[C@@H]1CN(CC)C[C@H]1O.O=C(O)/C=C/C(=O)O.
What is the InChIKey of (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide?
The InChIKey is SHNZSHRMJPVMST-GVNJZHQWSA-N. The full InChI is InChI=1S/C17H26N2O2.C4H4O4/c1-3-5-11-19(15-12-18(4-2)13-16(15)20)17(21)14-9-7-6-8-10-14;5-3(6)1-2-4(7)8/h6-10,15-16,20H,3-5,11-13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,16-;/m1./s1.
What are the key properties of (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide?
(E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide has a molecular weight of 406.48 g/mol, XLogP of 1.71, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-but-2-enedioic acid;N-butyl-N-[(3R,4R)-1-ethyl-4-hydroxypyrrolidin-3-yl]benzamide is sourced from PubChem (CID 88762037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).