About dichlorocopper;N,N-dimethylmethanamine
dichlorocopper;N,N-dimethylmethanamine (PubChem CID 88762816) has the molecular formula C3H9Cl2CuN
and a molecular weight of 193.56 g/mol. Its IUPAC name is dichlorocopper;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | dichlorocopper;N,N-dimethylmethanamine |
| PubChem CID | 88762816 |
| Molecular Formula | C3H9Cl2CuN |
| Molecular Weight | 193.56 g/mol |
| Exact Mass | 191.94 |
| IUPAC Name | dichlorocopper;N,N-dimethylmethanamine |
| SMILES | CN(C)C.Cl[Cu]Cl |
| InChI | InChI=1S/C3H9N.2ClH.Cu/c1-4(2)3;;;/h1-3H3;2*1H;/q;;;+2/p-2 |
| InChIKey | IIXLMCRNRMKVIY-UHFFFAOYSA-L |
| XLogP | 1.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze dichlorocopper;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorocopper;N,N-dimethylmethanamine?
The IUPAC name of dichlorocopper;N,N-dimethylmethanamine (CID 88762816) is dichlorocopper;N,N-dimethylmethanamine.
What is the SMILES notation for dichlorocopper;N,N-dimethylmethanamine?
The canonical SMILES for dichlorocopper;N,N-dimethylmethanamine is CN(C)C.Cl[Cu]Cl.
What is the InChIKey of dichlorocopper;N,N-dimethylmethanamine?
The InChIKey is IIXLMCRNRMKVIY-UHFFFAOYSA-L. The full InChI is InChI=1S/C3H9N.2ClH.Cu/c1-4(2)3;;;/h1-3H3;2*1H;/q;;;+2/p-2.
What are the key properties of dichlorocopper;N,N-dimethylmethanamine?
dichlorocopper;N,N-dimethylmethanamine has a molecular weight of 193.56 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorocopper;N,N-dimethylmethanamine is sourced from PubChem (CID 88762816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).