About 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione
1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione (PubChem CID 88762963) has the molecular formula C24H44O7
and a molecular weight of 444.61 g/mol. Its IUPAC name is 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione.
Molecular Properties
| Compound Name | 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione |
| PubChem CID | 88762963 |
| Molecular Formula | C24H44O7 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione |
| SMILES | CCOCC(=O)CCC(C)(CCC(=O)C(C)OC)C(CC(C)(CC(C)O)OC)C(C)=O |
| InChI | InChI=1S/C24H44O7/c1-9-31-16-20(27)10-12-23(5,13-11-22(28)19(4)29-7)21(18(3)26)15-24(6,30-8)14-17(2)25/h17,19,21,25H,9-16H2,1-8H3 |
| InChIKey | YTSLLMHVPVDVBK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione?
The IUPAC name of 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione (CID 88762963) is 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione.
What is the SMILES notation for 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione?
The canonical SMILES for 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione is CCOCC(=O)CCC(C)(CCC(=O)C(C)OC)C(CC(C)(CC(C)O)OC)C(C)=O.
What is the InChIKey of 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione?
The InChIKey is YTSLLMHVPVDVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44O7/c1-9-31-16-20(27)10-12-23(5,13-11-22(28)19(4)29-7)21(18(3)26)15-24(6,30-8)14-17(2)25/h17,19,21,25H,9-16H2,1-8H3.
What are the key properties of 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione?
1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione has a molecular weight of 444.61 g/mol, XLogP of 3.53, 18 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxy-5-(7-hydroxy-5-methoxy-5-methyl-2-oxooctan-3-yl)-9-methoxy-5-methyldecane-2,8-dione is sourced from PubChem (CID 88762963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).