About 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline
1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline (PubChem CID 88763109) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline.
Molecular Properties
| Compound Name | 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline |
| PubChem CID | 88763109 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline |
| SMILES | ON1C=CCC2=CC3=CC=CNC3C=C21 |
| InChI | InChI=1S/C12H12N2O/c15-14-6-2-4-10-7-9-3-1-5-13-11(9)8-12(10)14/h1-3,5-8,11,13,15H,4H2 |
| InChIKey | SCAFLNPYGZOFEY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline?
The IUPAC name of 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline (CID 88763109) is 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline.
What is the SMILES notation for 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline?
The canonical SMILES for 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline is ON1C=CCC2=CC3=CC=CNC3C=C21.
What is the InChIKey of 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline?
The InChIKey is SCAFLNPYGZOFEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c15-14-6-2-4-10-7-9-3-1-5-13-11(9)8-12(10)14/h1-3,5-8,11,13,15H,4H2.
What are the key properties of 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline?
1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline has a molecular weight of 200.24 g/mol, XLogP of 1.83, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-9,9a-dihydro-4H-pyrido[3,2-g]quinoline is sourced from PubChem (CID 88763109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).