C17H20O6 — CID 88764091
3,6-diacetyloxy-6-[(2E,4E)-hexa-2,4-dienyl]cyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 88764091) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is 3,6-diacetyloxy-6-[(2E,4E)-hexa-2,4-dienyl]cyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 3,6-diacetyloxy-6-[(2E,4E)-hexa-2,4-dienyl]cyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 88764091 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 3,6-diacetyloxy-6-[(2E,4E)-hexa-2,4-dienyl]cyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | C/C=C/C=C/CC1(OC(C)=O)C=CC(OC(C)=O)=CC1C(=O)O |
| InChI | InChI=1S/C17H20O6/c1-4-5-6-7-9-17(23-13(3)19)10-8-14(22-12(2)18)11-15(17)16(20)21/h4-8,10-11,15H,9H2,1-3H3,(H,20,21)/b5-4+,7-6+ |
| InChIKey | RSFJHEUMYJEIRW-YTXTXJHMSA-N |
| XLogP | 2.53 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|