3-hexadecylsulfanylpropanoyl chloride

C19H37ClOS — CID 88764265

IUPAC3-hexadecylsulfanylpropanoyl chloride
SMILESCCCCCCCCCCCCCCCCSCCC(=O)Cl
InChIInChI=1S/C19H37ClOS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-22-18-16-19(20)21/h2-18H2,1H3
InChIKeyOLEGFHZKMITQBB-UHFFFAOYSA-N
MW349.02 g/mol
LogP7.36
Rot. Bonds18

About 3-hexadecylsulfanylpropanoyl chloride

3-hexadecylsulfanylpropanoyl chloride (PubChem CID 88764265) has the molecular formula C19H37ClOS and a molecular weight of 349.02 g/mol. Its IUPAC name is 3-hexadecylsulfanylpropanoyl chloride.

Molecular Properties

Compound Name3-hexadecylsulfanylpropanoyl chloride
PubChem CID88764265
Molecular FormulaC19H37ClOS
Molecular Weight349.02 g/mol
Exact Mass348.23
IUPAC Name3-hexadecylsulfanylpropanoyl chloride
SMILESCCCCCCCCCCCCCCCCSCCC(=O)Cl
InChIInChI=1S/C19H37ClOS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-22-18-16-19(20)21/h2-18H2,1H3
InChIKeyOLEGFHZKMITQBB-UHFFFAOYSA-N
XLogP7.36
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds18
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500349.02
LogP ≤ 57.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-hexadecylsulfanylpropanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hexadecylsulfanylpropanoyl chloride?
The IUPAC name of 3-hexadecylsulfanylpropanoyl chloride (CID 88764265) is 3-hexadecylsulfanylpropanoyl chloride.
What is the SMILES notation for 3-hexadecylsulfanylpropanoyl chloride?
The canonical SMILES for 3-hexadecylsulfanylpropanoyl chloride is CCCCCCCCCCCCCCCCSCCC(=O)Cl.
What is the InChIKey of 3-hexadecylsulfanylpropanoyl chloride?
The InChIKey is OLEGFHZKMITQBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37ClOS/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-22-18-16-19(20)21/h2-18H2,1H3.
What are the key properties of 3-hexadecylsulfanylpropanoyl chloride?
3-hexadecylsulfanylpropanoyl chloride has a molecular weight of 349.02 g/mol, XLogP of 7.36, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexadecylsulfanylpropanoyl chloride is sourced from PubChem (CID 88764265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).