About 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide
6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide (PubChem CID 88764425) has the molecular formula C24H16O4P2
and a molecular weight of 430.34 g/mol. Its IUPAC name is 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide.
Molecular Properties
| Compound Name | 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide |
| PubChem CID | 88764425 |
| Molecular Formula | C24H16O4P2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide |
| SMILES | O=P1(OP2Oc3ccccc3-c3ccccc32)Oc2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C24H16O4P2/c25-30(24-16-8-4-12-20(24)18-10-2-6-14-22(18)27-30)28-29-23-15-7-3-11-19(23)17-9-1-5-13-21(17)26-29/h1-16H |
| InChIKey | QCNIWDLLBILKNG-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
The IUPAC name of 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide (CID 88764425) is 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide.
What is the SMILES notation for 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
The canonical SMILES for 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide is O=P1(OP2Oc3ccccc3-c3ccccc32)Oc2ccccc2-c2ccccc21.
What is the InChIKey of 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
The InChIKey is QCNIWDLLBILKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16O4P2/c25-30(24-16-8-4-12-20(24)18-10-2-6-14-22(18)27-30)28-29-23-15-7-3-11-19(23)17-9-1-5-13-21(17)26-29/h1-16H.
What are the key properties of 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide?
6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide has a molecular weight of 430.34 g/mol, XLogP of 6.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzo[c][2,1]benzoxaphosphinin-6-yloxybenzo[c][2,1]benzoxaphosphinine 6-oxide is sourced from PubChem (CID 88764425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).