About tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane
tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane (PubChem CID 88764552) has the molecular formula C14H27NOS
and a molecular weight of 257.44 g/mol. Its IUPAC name is tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane.
Molecular Properties
| Compound Name | tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane |
| PubChem CID | 88764552 |
| Molecular Formula | C14H27NOS |
| Molecular Weight | 257.44 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane |
| SMILES | CC(C)(C)NC(=O)S.CC(C)=CC1CC1(C)C |
| InChI | InChI=1S/C9H16.C5H11NOS/c1-7(2)5-8-6-9(8,3)4;1-5(2,3)6-4(7)8/h5,8H,6H2,1-4H3;1-3H3,(H2,6,7,8) |
| InChIKey | HADJWMDYHVKRFH-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane?
The IUPAC name of tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane (CID 88764552) is tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane.
What is the SMILES notation for tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane?
The canonical SMILES for tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane is CC(C)(C)NC(=O)S.CC(C)=CC1CC1(C)C.
What is the InChIKey of tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane?
The InChIKey is HADJWMDYHVKRFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16.C5H11NOS/c1-7(2)5-8-6-9(8,3)4;1-5(2,3)6-4(7)8/h5,8H,6H2,1-4H3;1-3H3,(H2,6,7,8).
What are the key properties of tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane?
tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane has a molecular weight of 257.44 g/mol, XLogP of 4.42, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butylcarbamothioic S-acid;1,1-dimethyl-2-(2-methylprop-1-enyl)cyclopropane is sourced from PubChem (CID 88764552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).