C11F25NO2S — CID 88764763
N,N,1,1,2,2,3,3-octafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)propan-1-amine (PubChem CID 88764763) has the molecular formula C11F25NO2S and a molecular weight of 685.14 g/mol. Its IUPAC name is N,N,1,1,2,2,3,3-octafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)propan-1-amine.
| Compound Name | N,N,1,1,2,2,3,3-octafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)propan-1-amine |
|---|---|
| PubChem CID | 88764763 |
| Molecular Formula | C11F25NO2S |
| Molecular Weight | 685.14 g/mol |
| Exact Mass | 684.93 |
| IUPAC Name | N,N,1,1,2,2,3,3-octafluoro-3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylsulfonyl)propan-1-amine |
| SMILES | O=S(=O)(C(F)(F)C(F)(F)C(F)(F)N(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11F25NO2S/c12-1(13,3(16,17)5(20,21)8(26,27)28)2(14,15)4(18,19)6(22,23)10(31,32)40(38,39)11(33,34)7(24,25)9(29,30)37(35)36 |
| InChIKey | IHYKAFBQNCMHKF-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.14 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|