About benzoic acid;cadmium;21,22-dihydroporphyrin
benzoic acid;cadmium;21,22-dihydroporphyrin (PubChem CID 88764917) has the molecular formula C27H19CdN4O2-
and a molecular weight of 543.89 g/mol. Its IUPAC name is benzoic acid;cadmium;21,22-dihydroporphyrin.
Molecular Properties
| Compound Name | benzoic acid;cadmium;21,22-dihydroporphyrin |
| PubChem CID | 88764917 |
| Molecular Formula | C27H19CdN4O2- |
| Molecular Weight | 543.89 g/mol |
| Exact Mass | 545.05 |
| IUPAC Name | benzoic acid;cadmium;21,22-dihydroporphyrin |
| SMILES | C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O=C(O)c1cc[c-]cc1.[Cd] |
| InChI | InChI=1S/C20H14N4.C7H5O2.Cd/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;8-7(9)6-4-2-1-3-5-6;/h1-12,21-22H;2-5H,(H,8,9);/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | JYYCPMGDTHAUKR-IAULSPAKSA-N |
| XLogP | 5.84 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.89 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;cadmium;21,22-dihydroporphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;cadmium;21,22-dihydroporphyrin?
The IUPAC name of benzoic acid;cadmium;21,22-dihydroporphyrin (CID 88764917) is benzoic acid;cadmium;21,22-dihydroporphyrin.
What is the SMILES notation for benzoic acid;cadmium;21,22-dihydroporphyrin?
The canonical SMILES for benzoic acid;cadmium;21,22-dihydroporphyrin is C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.O=C(O)c1cc[c-]cc1.[Cd].
What is the InChIKey of benzoic acid;cadmium;21,22-dihydroporphyrin?
The InChIKey is JYYCPMGDTHAUKR-IAULSPAKSA-N. The full InChI is InChI=1S/C20H14N4.C7H5O2.Cd/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;8-7(9)6-4-2-1-3-5-6;/h1-12,21-22H;2-5H,(H,8,9);/q;-1;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;;.
What are the key properties of benzoic acid;cadmium;21,22-dihydroporphyrin?
benzoic acid;cadmium;21,22-dihydroporphyrin has a molecular weight of 543.89 g/mol, XLogP of 5.84, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;cadmium;21,22-dihydroporphyrin is sourced from PubChem (CID 88764917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).