About (4-methylpiperazin-1-yl)methyl methanedithioate
(4-methylpiperazin-1-yl)methyl methanedithioate (PubChem CID 88765527) has the molecular formula C7H14N2S2
and a molecular weight of 190.34 g/mol. Its IUPAC name is (4-methylpiperazin-1-yl)methyl methanedithioate.
Molecular Properties
| Compound Name | (4-methylpiperazin-1-yl)methyl methanedithioate |
| PubChem CID | 88765527 |
| Molecular Formula | C7H14N2S2 |
| Molecular Weight | 190.34 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | (4-methylpiperazin-1-yl)methyl methanedithioate |
| SMILES | CN1CCN(CSC=S)CC1 |
| InChI | InChI=1S/C7H14N2S2/c1-8-2-4-9(5-3-8)6-11-7-10/h7H,2-6H2,1H3 |
| InChIKey | KSJCXEGMRWAJAV-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methylpiperazin-1-yl)methyl methanedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylpiperazin-1-yl)methyl methanedithioate?
The IUPAC name of (4-methylpiperazin-1-yl)methyl methanedithioate (CID 88765527) is (4-methylpiperazin-1-yl)methyl methanedithioate.
What is the SMILES notation for (4-methylpiperazin-1-yl)methyl methanedithioate?
The canonical SMILES for (4-methylpiperazin-1-yl)methyl methanedithioate is CN1CCN(CSC=S)CC1.
What is the InChIKey of (4-methylpiperazin-1-yl)methyl methanedithioate?
The InChIKey is KSJCXEGMRWAJAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S2/c1-8-2-4-9(5-3-8)6-11-7-10/h7H,2-6H2,1H3.
What are the key properties of (4-methylpiperazin-1-yl)methyl methanedithioate?
(4-methylpiperazin-1-yl)methyl methanedithioate has a molecular weight of 190.34 g/mol, XLogP of 0.88, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylpiperazin-1-yl)methyl methanedithioate is sourced from PubChem (CID 88765527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).