(2,4-dichloroquinazolin-6-yl) carbonochloridate

C9H3Cl3N2O2 — CID 88765606

IUPAC(2,4-dichloroquinazolin-6-yl) carbonochloridate
SMILESO=C(Cl)Oc1ccc2nc(Cl)nc(Cl)c2c1
InChIInChI=1S/C9H3Cl3N2O2/c10-7-5-3-4(16-9(12)15)1-2-6(5)13-8(11)14-7/h1-3H
InChIKeyBWJOTXXMBMIDCD-UHFFFAOYSA-N
MW277.49 g/mol
LogP3.67
Rot. Bonds1

About (2,4-dichloroquinazolin-6-yl) carbonochloridate

(2,4-dichloroquinazolin-6-yl) carbonochloridate (PubChem CID 88765606) has the molecular formula C9H3Cl3N2O2 and a molecular weight of 277.49 g/mol. Its IUPAC name is (2,4-dichloroquinazolin-6-yl) carbonochloridate.

Molecular Properties

Compound Name(2,4-dichloroquinazolin-6-yl) carbonochloridate
PubChem CID88765606
Molecular FormulaC9H3Cl3N2O2
Molecular Weight277.49 g/mol
Exact Mass275.93
IUPAC Name(2,4-dichloroquinazolin-6-yl) carbonochloridate
SMILESO=C(Cl)Oc1ccc2nc(Cl)nc(Cl)c2c1
InChIInChI=1S/C9H3Cl3N2O2/c10-7-5-3-4(16-9(12)15)1-2-6(5)13-8(11)14-7/h1-3H
InChIKeyBWJOTXXMBMIDCD-UHFFFAOYSA-N
XLogP3.67
TPSA52.08 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.49
LogP ≤ 53.67
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (2,4-dichloroquinazolin-6-yl) carbonochloridate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2,4-dichloroquinazolin-6-yl) carbonochloridate?
The IUPAC name of (2,4-dichloroquinazolin-6-yl) carbonochloridate (CID 88765606) is (2,4-dichloroquinazolin-6-yl) carbonochloridate.
What is the SMILES notation for (2,4-dichloroquinazolin-6-yl) carbonochloridate?
The canonical SMILES for (2,4-dichloroquinazolin-6-yl) carbonochloridate is O=C(Cl)Oc1ccc2nc(Cl)nc(Cl)c2c1.
What is the InChIKey of (2,4-dichloroquinazolin-6-yl) carbonochloridate?
The InChIKey is BWJOTXXMBMIDCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3Cl3N2O2/c10-7-5-3-4(16-9(12)15)1-2-6(5)13-8(11)14-7/h1-3H.
What are the key properties of (2,4-dichloroquinazolin-6-yl) carbonochloridate?
(2,4-dichloroquinazolin-6-yl) carbonochloridate has a molecular weight of 277.49 g/mol, XLogP of 3.67, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dichloroquinazolin-6-yl) carbonochloridate is sourced from PubChem (CID 88765606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).