About 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium)
2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) (PubChem CID 88765663) has the molecular formula C5H13NO10P2+2
and a molecular weight of 309.10 g/mol. Its IUPAC name is 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium).
Molecular Properties
| Compound Name | 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) |
| PubChem CID | 88765663 |
| Molecular Formula | C5H13NO10P2+2 |
| Molecular Weight | 309.10 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) |
| SMILES | CN(CC(=O)O)CC(=O)O.O=[P+](O)O.O=[P+](O)O |
| InChI | InChI=1S/C5H9NO4.2HO3P/c1-6(2-4(7)8)3-5(9)10;2*1-4(2)3/h2-3H2,1H3,(H,7,8)(H,9,10);2*(H-,1,2,3)/p+2 |
| InChIKey | NNRYQARIJJFSIF-UHFFFAOYSA-P |
| XLogP | -1.66 |
| TPSA | 192.90 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.10 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium)?
The IUPAC name of 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) (CID 88765663) is 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium).
What is the SMILES notation for 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium)?
The canonical SMILES for 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) is CN(CC(=O)O)CC(=O)O.O=[P+](O)O.O=[P+](O)O.
What is the InChIKey of 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium)?
The InChIKey is NNRYQARIJJFSIF-UHFFFAOYSA-P. The full InChI is InChI=1S/C5H9NO4.2HO3P/c1-6(2-4(7)8)3-5(9)10;2*1-4(2)3/h2-3H2,1H3,(H,7,8)(H,9,10);2*(H-,1,2,3)/p+2.
What are the key properties of 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium)?
2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) has a molecular weight of 309.10 g/mol, XLogP of -1.66, 4 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carboxymethyl(methyl)amino]acetic acid;bis(dihydroxy(oxo)phosphanium) is sourced from PubChem (CID 88765663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).