About (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone
(1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone (PubChem CID 88765932) has the molecular formula C11H14N2OS
and a molecular weight of 222.31 g/mol. Its IUPAC name is (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone.
Molecular Properties
| Compound Name | (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone |
| PubChem CID | 88765932 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone |
| SMILES | Cc1cccc(C(=O)C2=S(N)CCN2)c1 |
| InChI | InChI=1S/C11H14N2OS/c1-8-3-2-4-9(7-8)10(14)11-13-5-6-15(11)12/h2-4,7,13H,5-6,12H2,1H3 |
| InChIKey | UIMSELRUEHBXNX-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone?
The IUPAC name of (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone (CID 88765932) is (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone.
What is the SMILES notation for (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone?
The canonical SMILES for (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone is Cc1cccc(C(=O)C2=S(N)CCN2)c1.
What is the InChIKey of (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone?
The InChIKey is UIMSELRUEHBXNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2OS/c1-8-3-2-4-9(7-8)10(14)11-13-5-6-15(11)12/h2-4,7,13H,5-6,12H2,1H3.
What are the key properties of (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone?
(1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone has a molecular weight of 222.31 g/mol, XLogP of 1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-4,5-dihydro-3H-1,3-thiazol-2-yl)-(3-methylphenyl)methanone is sourced from PubChem (CID 88765932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).