About formamide;2-methylpropanal
formamide;2-methylpropanal (PubChem CID 88766123) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is formamide;2-methylpropanal.
Molecular Properties
| Compound Name | formamide;2-methylpropanal |
| PubChem CID | 88766123 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | formamide;2-methylpropanal |
| SMILES | CC(C)C=O.NC=O |
| InChI | InChI=1S/C4H8O.CH3NO/c1-4(2)3-5;2-1-3/h3-4H,1-2H3;1H,(H2,2,3) |
| InChIKey | JNTDYWLPVCJWQO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formamide;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;2-methylpropanal?
The IUPAC name of formamide;2-methylpropanal (CID 88766123) is formamide;2-methylpropanal.
What is the SMILES notation for formamide;2-methylpropanal?
The canonical SMILES for formamide;2-methylpropanal is CC(C)C=O.NC=O.
What is the InChIKey of formamide;2-methylpropanal?
The InChIKey is JNTDYWLPVCJWQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.CH3NO/c1-4(2)3-5;2-1-3/h3-4H,1-2H3;1H,(H2,2,3).
What are the key properties of formamide;2-methylpropanal?
formamide;2-methylpropanal has a molecular weight of 117.15 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;2-methylpropanal is sourced from PubChem (CID 88766123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).