About 4-methoxypent-2-ene-1,5-diol
4-methoxypent-2-ene-1,5-diol (PubChem CID 88766415) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is 4-methoxypent-2-ene-1,5-diol.
Molecular Properties
| Compound Name | 4-methoxypent-2-ene-1,5-diol |
| PubChem CID | 88766415 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | 4-methoxypent-2-ene-1,5-diol |
| SMILES | COC(C=CCO)CO |
| InChI | InChI=1S/C6H12O3/c1-9-6(5-8)3-2-4-7/h2-3,6-8H,4-5H2,1H3 |
| InChIKey | GBFUWGOSFNGFPJ-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxypent-2-ene-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxypent-2-ene-1,5-diol?
The IUPAC name of 4-methoxypent-2-ene-1,5-diol (CID 88766415) is 4-methoxypent-2-ene-1,5-diol.
What is the SMILES notation for 4-methoxypent-2-ene-1,5-diol?
The canonical SMILES for 4-methoxypent-2-ene-1,5-diol is COC(C=CCO)CO.
What is the InChIKey of 4-methoxypent-2-ene-1,5-diol?
The InChIKey is GBFUWGOSFNGFPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3/c1-9-6(5-8)3-2-4-7/h2-3,6-8H,4-5H2,1H3.
What are the key properties of 4-methoxypent-2-ene-1,5-diol?
4-methoxypent-2-ene-1,5-diol has a molecular weight of 132.16 g/mol, XLogP of -0.46, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxypent-2-ene-1,5-diol is sourced from PubChem (CID 88766415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).