About 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde
1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde (PubChem CID 88766542) has the molecular formula C10H14O4S
and a molecular weight of 230.28 g/mol. Its IUPAC name is 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde.
Molecular Properties
| Compound Name | 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde |
| PubChem CID | 88766542 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.28 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde |
| SMILES | COC(C)OC.O=Cc1ccsc1C=O |
| InChI | InChI=1S/C6H4O2S.C4H10O2/c7-3-5-1-2-9-6(5)4-8;1-4(5-2)6-3/h1-4H;4H,1-3H3 |
| InChIKey | DVHATIZVMLDVCU-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde?
The IUPAC name of 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde (CID 88766542) is 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde.
What is the SMILES notation for 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde?
The canonical SMILES for 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde is COC(C)OC.O=Cc1ccsc1C=O.
What is the InChIKey of 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde?
The InChIKey is DVHATIZVMLDVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4O2S.C4H10O2/c7-3-5-1-2-9-6(5)4-8;1-4(5-2)6-3/h1-4H;4H,1-3H3.
What are the key properties of 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde?
1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde has a molecular weight of 230.28 g/mol, XLogP of 2.00, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dimethoxyethane;thiophene-2,3-dicarbaldehyde is sourced from PubChem (CID 88766542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).