About benzoic acid;2-(chloromethyl)benzenesulfonic acid
benzoic acid;2-(chloromethyl)benzenesulfonic acid (PubChem CID 88766672) has the molecular formula C14H13ClO5S
and a molecular weight of 328.77 g/mol. Its IUPAC name is benzoic acid;2-(chloromethyl)benzenesulfonic acid.
Molecular Properties
| Compound Name | benzoic acid;2-(chloromethyl)benzenesulfonic acid |
| PubChem CID | 88766672 |
| Molecular Formula | C14H13ClO5S |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | benzoic acid;2-(chloromethyl)benzenesulfonic acid |
| SMILES | O=C(O)c1ccccc1.O=S(=O)(O)c1ccccc1CCl |
| InChI | InChI=1S/C7H7ClO3S.C7H6O2/c8-5-6-3-1-2-4-7(6)12(9,10)11;8-7(9)6-4-2-1-3-5-6/h1-4H,5H2,(H,9,10,11);1-5H,(H,8,9) |
| InChIKey | ZEGNMFZDJVFTKA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzoic acid;2-(chloromethyl)benzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;2-(chloromethyl)benzenesulfonic acid?
The IUPAC name of benzoic acid;2-(chloromethyl)benzenesulfonic acid (CID 88766672) is benzoic acid;2-(chloromethyl)benzenesulfonic acid.
What is the SMILES notation for benzoic acid;2-(chloromethyl)benzenesulfonic acid?
The canonical SMILES for benzoic acid;2-(chloromethyl)benzenesulfonic acid is O=C(O)c1ccccc1.O=S(=O)(O)c1ccccc1CCl.
What is the InChIKey of benzoic acid;2-(chloromethyl)benzenesulfonic acid?
The InChIKey is ZEGNMFZDJVFTKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClO3S.C7H6O2/c8-5-6-3-1-2-4-7(6)12(9,10)11;8-7(9)6-4-2-1-3-5-6/h1-4H,5H2,(H,9,10,11);1-5H,(H,8,9).
What are the key properties of benzoic acid;2-(chloromethyl)benzenesulfonic acid?
benzoic acid;2-(chloromethyl)benzenesulfonic acid has a molecular weight of 328.77 g/mol, XLogP of 3.06, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;2-(chloromethyl)benzenesulfonic acid is sourced from PubChem (CID 88766672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).