C16H17N2O5+ — CID 88767083
(E)-2-(3-ethyl-2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl)but-2-enedioic acid (PubChem CID 88767083) has the molecular formula C16H17N2O5+ and a molecular weight of 317.32 g/mol. Its IUPAC name is (E)-2-(3-ethyl-2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl)but-2-enedioic acid.
| Compound Name | (E)-2-(3-ethyl-2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 88767083 |
| Molecular Formula | C16H17N2O5+ |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | (E)-2-(3-ethyl-2,6-dimethyl-4-oxopyrido[1,2-a]pyrimidin-1-ium-1-yl)but-2-enedioic acid |
| SMILES | CCc1c(C)[n+](/C(=C/C(=O)O)C(=O)O)c2cccc(C)n2c1=O |
| InChI | InChI=1S/C16H16N2O5/c1-4-11-10(3)18(12(16(22)23)8-14(19)20)13-7-5-6-9(2)17(13)15(11)21/h5-8H,4H2,1-3H3,(H-,19,20,22,23)/p+1/b12-8+ |
| InChIKey | JEZAGNXIKJJADT-XYOKQWHBSA-O |
| XLogP | 0.78 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|