About N'-ethenyloxamide
N'-ethenyloxamide (PubChem CID 88767216) has the molecular formula C4H6N2O2
and a molecular weight of 114.10 g/mol. Its IUPAC name is N'-ethenyloxamide.
Molecular Properties
| Compound Name | N'-ethenyloxamide |
| PubChem CID | 88767216 |
| Molecular Formula | C4H6N2O2 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.04 |
| IUPAC Name | N'-ethenyloxamide |
| SMILES | C=CNC(=O)C(N)=O |
| InChI | InChI=1S/C4H6N2O2/c1-2-6-4(8)3(5)7/h2H,1H2,(H2,5,7)(H,6,8) |
| InChIKey | LIVVOSHPRDIGFA-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-ethenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethenyloxamide?
The IUPAC name of N'-ethenyloxamide (CID 88767216) is N'-ethenyloxamide.
What is the SMILES notation for N'-ethenyloxamide?
The canonical SMILES for N'-ethenyloxamide is C=CNC(=O)C(N)=O.
What is the InChIKey of N'-ethenyloxamide?
The InChIKey is LIVVOSHPRDIGFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2/c1-2-6-4(8)3(5)7/h2H,1H2,(H2,5,7)(H,6,8).
What are the key properties of N'-ethenyloxamide?
N'-ethenyloxamide has a molecular weight of 114.10 g/mol, XLogP of -1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethenyloxamide is sourced from PubChem (CID 88767216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).