C17H34N2O — CID 88767301
1,2,2,6,6-pentamethyl-N-[1-(oxiran-2-yl)pentan-2-yl]piperidin-4-amine (PubChem CID 88767301) has the molecular formula C17H34N2O and a molecular weight of 282.47 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-N-[1-(oxiran-2-yl)pentan-2-yl]piperidin-4-amine.
| Compound Name | 1,2,2,6,6-pentamethyl-N-[1-(oxiran-2-yl)pentan-2-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 88767301 |
| Molecular Formula | C17H34N2O |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.27 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-N-[1-(oxiran-2-yl)pentan-2-yl]piperidin-4-amine |
| SMILES | CCCC(CC1CO1)NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C17H34N2O/c1-7-8-13(9-15-12-20-15)18-14-10-16(2,3)19(6)17(4,5)11-14/h13-15,18H,7-12H2,1-6H3 |
| InChIKey | YDWVHDPBRVLPBB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 27.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|