About 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene
3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 88767359) has the molecular formula C13H20S2
and a molecular weight of 240.44 g/mol. Its IUPAC name is 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene.
Molecular Properties
| Compound Name | 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| PubChem CID | 88767359 |
| Molecular Formula | C13H20S2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C1=CSSC1.C=C(C)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C10H16.C3H4S2/c1-8(2)10-6-4-9(3)5-7-10;1-2-4-5-3-1/h4,10H,1,5-7H2,2-3H3;1-2H,3H2/t10-;/m0./s1 |
| InChIKey | UOTQFUXEBSPBLK-PPHPATTJSA-N |
| XLogP | 5.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene?
The IUPAC name of 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene (CID 88767359) is 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene.
What is the SMILES notation for 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene?
The canonical SMILES for 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene is C1=CSSC1.C=C(C)[C@H]1CC=C(C)CC1.
What is the InChIKey of 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene?
The InChIKey is UOTQFUXEBSPBLK-PPHPATTJSA-N. The full InChI is InChI=1S/C10H16.C3H4S2/c1-8(2)10-6-4-9(3)5-7-10;1-2-4-5-3-1/h4,10H,1,5-7H2,2-3H3;1-2H,3H2/t10-;/m0./s1.
What are the key properties of 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene?
3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene has a molecular weight of 240.44 g/mol, XLogP of 5.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-dithiole;(4R)-1-methyl-4-prop-1-en-2-ylcyclohexene is sourced from PubChem (CID 88767359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).