C17H34O4 — CID 88767661
2,2-bis(tert-butylperoxy)-1,1,4-trimethylcyclohexane (PubChem CID 88767661) has the molecular formula C17H34O4 and a molecular weight of 302.45 g/mol. Its IUPAC name is 2,2-bis(tert-butylperoxy)-1,1,4-trimethylcyclohexane.
| Compound Name | 2,2-bis(tert-butylperoxy)-1,1,4-trimethylcyclohexane |
|---|---|
| PubChem CID | 88767661 |
| Molecular Formula | C17H34O4 |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 2,2-bis(tert-butylperoxy)-1,1,4-trimethylcyclohexane |
| SMILES | CC1CCC(C)(C)C(OOC(C)(C)C)(OOC(C)(C)C)C1 |
| InChI | InChI=1S/C17H34O4/c1-13-10-11-16(8,9)17(12-13,20-18-14(2,3)4)21-19-15(5,6)7/h13H,10-12H2,1-9H3 |
| InChIKey | NCVXHVOHIQINEW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|