C32H22N4O3S — CID 88767727
7,8-diphenyl-21,24-dihydroporphyrin-2-sulfonic acid (PubChem CID 88767727) has the molecular formula C32H22N4O3S and a molecular weight of 542.62 g/mol. Its IUPAC name is 7,8-diphenyl-21,24-dihydroporphyrin-2-sulfonic acid.
| Compound Name | 7,8-diphenyl-21,24-dihydroporphyrin-2-sulfonic acid |
|---|---|
| PubChem CID | 88767727 |
| Molecular Formula | C32H22N4O3S |
| Molecular Weight | 542.62 g/mol |
| Exact Mass | 542.14 |
| IUPAC Name | 7,8-diphenyl-21,24-dihydroporphyrin-2-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc2cc3nc(cc4nc(cc5ccc(cc1[nH]2)[nH]5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C32H22N4O3S/c37-40(38,39)30-19-26-18-29-32(21-9-5-2-6-10-21)31(20-7-3-1-4-8-20)28(36-29)17-25-14-12-23(34-25)15-22-11-13-24(33-22)16-27(30)35-26/h1-19,33,35H,(H,37,38,39)/b22-15-,23-15-,24-16-,25-17-,26-18-,27-16-,28-17-,29-18- |
| InChIKey | QGHNXDVNJZNXIZ-WEMYAHEJSA-N |
| XLogP | 6.74 |
| TPSA | 111.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|