About 1-methyl-2H-1,2-thiazole-4-carboxylic acid
1-methyl-2H-1,2-thiazole-4-carboxylic acid (PubChem CID 88768012) has the molecular formula C5H7NO2S
and a molecular weight of 145.18 g/mol. Its IUPAC name is 1-methyl-2H-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-2H-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 88768012 |
| Molecular Formula | C5H7NO2S |
| Molecular Weight | 145.18 g/mol |
| Exact Mass | 145.02 |
| IUPAC Name | 1-methyl-2H-1,2-thiazole-4-carboxylic acid |
| SMILES | CS1=CC(C(=O)O)=CN1 |
| InChI | InChI=1S/C5H7NO2S/c1-9-3-4(2-6-9)5(7)8/h2-3,6H,1H3,(H,7,8) |
| InChIKey | OTWAVNNEYQJZBQ-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.18 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2H-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 1-methyl-2H-1,2-thiazole-4-carboxylic acid (CID 88768012) is 1-methyl-2H-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 1-methyl-2H-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 1-methyl-2H-1,2-thiazole-4-carboxylic acid is CS1=CC(C(=O)O)=CN1.
What is the InChIKey of 1-methyl-2H-1,2-thiazole-4-carboxylic acid?
The InChIKey is OTWAVNNEYQJZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7NO2S/c1-9-3-4(2-6-9)5(7)8/h2-3,6H,1H3,(H,7,8).
What are the key properties of 1-methyl-2H-1,2-thiazole-4-carboxylic acid?
1-methyl-2H-1,2-thiazole-4-carboxylic acid has a molecular weight of 145.18 g/mol, XLogP of 0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 88768012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).