C68H50N4 — CID 88768309
(10Z,14Z,19Z)-1,2,3,4,5,6,7,8-octakis-phenyl-21,23-dihydro-5H-porphyrin (PubChem CID 88768309) has the molecular formula C68H50N4 and a molecular weight of 923.18 g/mol. Its IUPAC name is (10Z,14Z,19Z)-1,2,3,4,5,6,7,8-octakis-phenyl-21,23-dihydro-5H-porphyrin.
| Compound Name | (10Z,14Z,19Z)-1,2,3,4,5,6,7,8-octakis-phenyl-21,23-dihydro-5H-porphyrin |
|---|---|
| PubChem CID | 88768309 |
| Molecular Formula | C68H50N4 |
| Molecular Weight | 923.18 g/mol |
| Exact Mass | 922.40 |
| IUPAC Name | (10Z,14Z,19Z)-1,2,3,4,5,6,7,8-octakis-phenyl-21,23-dihydro-5H-porphyrin |
| SMILES | C1=C/C2=C/C3(c4ccccc4)NC(c4ccccc4)(C(c4ccccc4)=C3c3ccccc3)C(c3ccccc3)C3(c4ccccc4)N=C(/C=c4/cc/c([nH]4)=C/C1=N2)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C68H50N4/c1-9-25-48(26-10-1)61-60-46-58-42-41-56(69-58)45-57-43-44-59(70-57)47-66(53-35-19-6-20-36-53)63(50-29-13-3-14-30-50)64(51-31-15-4-16-32-51)68(72-66,55-39-23-8-24-40-55)65(52-33-17-5-18-34-52)67(71-60,54-37-21-7-22-38-54)62(61)49-27-11-2-12-28-49/h1-47,65,69,72H/b56-45-,58-46-,59-47- |
| InChIKey | BRBAAGZPGVPMCS-SZLUODRNSA-N |
| XLogP | 13.23 |
| TPSA | 52.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.18 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|