C15H21NO4 — CID 88769135
(2S)-1-(3-ethynyl-5,5-dimethyl-4-oxohexanoyl)pyrrolidine-2-carboxylic acid (PubChem CID 88769135) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is (2S)-1-(3-ethynyl-5,5-dimethyl-4-oxohexanoyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3-ethynyl-5,5-dimethyl-4-oxohexanoyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88769135 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (2S)-1-(3-ethynyl-5,5-dimethyl-4-oxohexanoyl)pyrrolidine-2-carboxylic acid |
| SMILES | C#CC(CC(=O)N1CCC[C@H]1C(=O)O)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H21NO4/c1-5-10(13(18)15(2,3)4)9-12(17)16-8-6-7-11(16)14(19)20/h1,10-11H,6-9H2,2-4H3,(H,19,20)/t10?,11-/m0/s1 |
| InChIKey | DHJCCNPDBAUQCQ-DTIOYNMSSA-N |
| XLogP | 1.32 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|