About 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol
2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol (PubChem CID 88769479) has the molecular formula C8H18Cl2O4
and a molecular weight of 249.13 g/mol. Its IUPAC name is 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol.
Molecular Properties
| Compound Name | 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol |
| PubChem CID | 88769479 |
| Molecular Formula | C8H18Cl2O4 |
| Molecular Weight | 249.13 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol |
| SMILES | COC(CO)C(Cl)CO.OCCCCl |
| InChI | InChI=1S/C5H11ClO3.C3H7ClO/c1-9-5(3-8)4(6)2-7;4-2-1-3-5/h4-5,7-8H,2-3H2,1H3;5H,1-3H2 |
| InChIKey | ZSMPRYFZVMAKDY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.13 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol?
The IUPAC name of 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol (CID 88769479) is 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol.
What is the SMILES notation for 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol?
The canonical SMILES for 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol is COC(CO)C(Cl)CO.OCCCCl.
What is the InChIKey of 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol?
The InChIKey is ZSMPRYFZVMAKDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClO3.C3H7ClO/c1-9-5(3-8)4(6)2-7;4-2-1-3-5/h4-5,7-8H,2-3H2,1H3;5H,1-3H2.
What are the key properties of 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol?
2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol has a molecular weight of 249.13 g/mol, XLogP of 0.20, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-3-methoxybutane-1,4-diol;3-chloropropan-1-ol is sourced from PubChem (CID 88769479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).