C12H19NO3S — CID 88769616
(2S)-1-(2-methyl-4-oxohexanethioyl)pyrrolidine-2-carboxylic acid (PubChem CID 88769616) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is (2S)-1-(2-methyl-4-oxohexanethioyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(2-methyl-4-oxohexanethioyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88769616 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (2S)-1-(2-methyl-4-oxohexanethioyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCC(=O)CC(C)C(=S)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H19NO3S/c1-3-9(14)7-8(2)11(17)13-6-4-5-10(13)12(15)16/h8,10H,3-7H2,1-2H3,(H,15,16)/t8?,10-/m0/s1 |
| InChIKey | SDKFWPQGJXCGEC-HTLJXXAVSA-N |
| XLogP | 1.87 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|