About N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide
N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide (PubChem CID 88769683) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide.
Molecular Properties
| Compound Name | N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide |
| PubChem CID | 88769683 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide |
| SMILES | CN(C)C(=O)C(=O)NC(=O)N1CC1C#N |
| InChI | InChI=1S/C8H10N4O3/c1-11(2)7(14)6(13)10-8(15)12-4-5(12)3-9/h5H,4H2,1-2H3,(H,10,13,15) |
| InChIKey | SZOSUHVUOKEMSQ-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide?
The IUPAC name of N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide (CID 88769683) is N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide.
What is the SMILES notation for N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide?
The canonical SMILES for N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide is CN(C)C(=O)C(=O)NC(=O)N1CC1C#N.
What is the InChIKey of N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide?
The InChIKey is SZOSUHVUOKEMSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3/c1-11(2)7(14)6(13)10-8(15)12-4-5(12)3-9/h5H,4H2,1-2H3,(H,10,13,15).
What are the key properties of N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide?
N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide has a molecular weight of 210.19 g/mol, XLogP of -1.48, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-cyanoaziridine-1-carbonyl)-N',N'-dimethyloxamide is sourced from PubChem (CID 88769683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).