About 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid
3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid (PubChem CID 88769734) has the molecular formula C17H15F3O2S2
and a molecular weight of 372.43 g/mol. Its IUPAC name is 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid.
Molecular Properties
| Compound Name | 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid |
| PubChem CID | 88769734 |
| Molecular Formula | C17H15F3O2S2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid |
| SMILES | O=C(O)CC(C(Sc1ccccc1)Sc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H15F3O2S2/c18-17(19,20)14(11-15(21)22)16(23-12-7-3-1-4-8-12)24-13-9-5-2-6-10-13/h1-10,14,16H,11H2,(H,21,22) |
| InChIKey | LNFHZKKWWIEIIW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid?
The IUPAC name of 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid (CID 88769734) is 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid.
What is the SMILES notation for 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid?
The canonical SMILES for 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid is O=C(O)CC(C(Sc1ccccc1)Sc1ccccc1)C(F)(F)F.
What is the InChIKey of 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid?
The InChIKey is LNFHZKKWWIEIIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3O2S2/c18-17(19,20)14(11-15(21)22)16(23-12-7-3-1-4-8-12)24-13-9-5-2-6-10-13/h1-10,14,16H,11H2,(H,21,22).
What are the key properties of 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid?
3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid has a molecular weight of 372.43 g/mol, XLogP of 5.55, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(phenylsulfanyl)methyl]-4,4,4-trifluorobutanoic acid is sourced from PubChem (CID 88769734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).