About 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine
2-methyl-6-methylideneocta-2,7-diene-1,1-diamine (PubChem CID 88769812) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine.
Molecular Properties
| Compound Name | 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine |
| PubChem CID | 88769812 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine |
| SMILES | C=CC(=C)CCC=C(C)C(N)N |
| InChI | InChI=1S/C10H18N2/c1-4-8(2)6-5-7-9(3)10(11)12/h4,7,10H,1-2,5-6,11-12H2,3H3 |
| InChIKey | XDHAXGYXHLKKKZ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine?
The IUPAC name of 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine (CID 88769812) is 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine.
What is the SMILES notation for 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine?
The canonical SMILES for 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine is C=CC(=C)CCC=C(C)C(N)N.
What is the InChIKey of 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine?
The InChIKey is XDHAXGYXHLKKKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-8(2)6-5-7-9(3)10(11)12/h4,7,10H,1-2,5-6,11-12H2,3H3.
What are the key properties of 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine?
2-methyl-6-methylideneocta-2,7-diene-1,1-diamine has a molecular weight of 166.27 g/mol, XLogP of 1.70, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-methylideneocta-2,7-diene-1,1-diamine is sourced from PubChem (CID 88769812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).