C20H37NO3 — CID 88769815
(9Z,12Z)-N,N-bis(hydroxymethyl)octadeca-9,12-dienamide (PubChem CID 88769815) has the molecular formula C20H37NO3 and a molecular weight of 339.52 g/mol. Its IUPAC name is (9Z,12Z)-N,N-bis(hydroxymethyl)octadeca-9,12-dienamide.
| Compound Name | (9Z,12Z)-N,N-bis(hydroxymethyl)octadeca-9,12-dienamide |
|---|---|
| PubChem CID | 88769815 |
| Molecular Formula | C20H37NO3 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | (9Z,12Z)-N,N-bis(hydroxymethyl)octadeca-9,12-dienamide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)N(CO)CO |
| InChI | InChI=1S/C20H37NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)21(18-22)19-23/h6-7,9-10,22-23H,2-5,8,11-19H2,1H3/b7-6-,10-9- |
| InChIKey | VYUBIRDROORXJX-HZJYTTRNSA-N |
| XLogP | 4.53 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|