About N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine
N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine (PubChem CID 88769907) has the molecular formula C6H8N2S2
and a molecular weight of 172.28 g/mol. Its IUPAC name is N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine.
Molecular Properties
| Compound Name | N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine |
| PubChem CID | 88769907 |
| Molecular Formula | C6H8N2S2 |
| Molecular Weight | 172.28 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine |
| SMILES | C=CCN(S)c1nccs1 |
| InChI | InChI=1S/C6H8N2S2/c1-2-4-8(9)6-7-3-5-10-6/h2-3,5,9H,1,4H2 |
| InChIKey | NINANHYJXVSVID-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 16.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine?
The IUPAC name of N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine (CID 88769907) is N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine.
What is the SMILES notation for N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine?
The canonical SMILES for N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine is C=CCN(S)c1nccs1.
What is the InChIKey of N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine?
The InChIKey is NINANHYJXVSVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2S2/c1-2-4-8(9)6-7-3-5-10-6/h2-3,5,9H,1,4H2.
What are the key properties of N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine?
N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine has a molecular weight of 172.28 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-prop-2-enyl-N-(1,3-thiazol-2-yl)thiohydroxylamine is sourced from PubChem (CID 88769907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).