C20H21ClN4O — CID 88770170
1-(10-chloro-7-methylindolo[2,3-c]isoquinolin-5-yl)oxy-1-N,1-N'-dimethylethane-1,1-diamine (PubChem CID 88770170) has the molecular formula C20H21ClN4O and a molecular weight of 368.87 g/mol. Its IUPAC name is 1-(10-chloro-7-methylindolo[2,3-c]isoquinolin-5-yl)oxy-1-N,1-N'-dimethylethane-1,1-diamine.
| Compound Name | 1-(10-chloro-7-methylindolo[2,3-c]isoquinolin-5-yl)oxy-1-N,1-N'-dimethylethane-1,1-diamine |
|---|---|
| PubChem CID | 88770170 |
| Molecular Formula | C20H21ClN4O |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 1-(10-chloro-7-methylindolo[2,3-c]isoquinolin-5-yl)oxy-1-N,1-N'-dimethylethane-1,1-diamine |
| SMILES | CNC(C)(NC)Oc1nc2c(c3ccccc13)c1cc(Cl)ccc1n2C |
| InChI | InChI=1S/C20H21ClN4O/c1-20(22-2,23-3)26-19-14-8-6-5-7-13(14)17-15-11-12(21)9-10-16(15)25(4)18(17)24-19/h5-11,22-23H,1-4H3 |
| InChIKey | WYEHZHNBXBPQBC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|