About [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate
[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 88770190) has the molecular formula C9H12F3NO3S
and a molecular weight of 271.26 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 88770190 |
| Molecular Formula | C9H12F3NO3S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.05 |
| IUPAC Name | [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | O=C(OC(=O)[C@@H]1CCCN1)C(CS)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO3S/c10-9(11,12)5(4-17)7(14)16-8(15)6-2-1-3-13-6/h5-6,13,17H,1-4H2/t5?,6-/m0/s1 |
| InChIKey | CPMAMLSLDDVBDC-GDVGLLTNSA-N |
| XLogP | 0.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate (CID 88770190) is [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate is O=C(OC(=O)[C@@H]1CCCN1)C(CS)C(F)(F)F.
What is the InChIKey of [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate?
The InChIKey is CPMAMLSLDDVBDC-GDVGLLTNSA-N. The full InChI is InChI=1S/C9H12F3NO3S/c10-9(11,12)5(4-17)7(14)16-8(15)6-2-1-3-13-6/h5-6,13,17H,1-4H2/t5?,6-/m0/s1.
What are the key properties of [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate?
[3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate has a molecular weight of 271.26 g/mol, XLogP of 0.92, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,3,3-trifluoro-2-(sulfanylmethyl)propanoyl] (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 88770190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).