C7H10O5 — CID 88770359
7,7-dimethyl-1,3,5-trioxocane-2,4-dione (PubChem CID 88770359) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is 7,7-dimethyl-1,3,5-trioxocane-2,4-dione.
| Compound Name | 7,7-dimethyl-1,3,5-trioxocane-2,4-dione |
|---|---|
| PubChem CID | 88770359 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 7,7-dimethyl-1,3,5-trioxocane-2,4-dione |
| SMILES | CC1(C)COC(=O)OC(=O)OC1 |
| InChI | InChI=1S/C7H10O5/c1-7(2)3-10-5(8)12-6(9)11-4-7/h3-4H2,1-2H3 |
| InChIKey | IKCPXYGXEUKGHB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|