About ethyl N,N-bis(prop-2-enyl)carbamate;methanol
ethyl N,N-bis(prop-2-enyl)carbamate;methanol (PubChem CID 88770408) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is ethyl N,N-bis(prop-2-enyl)carbamate;methanol.
Molecular Properties
| Compound Name | ethyl N,N-bis(prop-2-enyl)carbamate;methanol |
| PubChem CID | 88770408 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | ethyl N,N-bis(prop-2-enyl)carbamate;methanol |
| SMILES | C=CCN(CC=C)C(=O)OCC.CO |
| InChI | InChI=1S/C9H15NO2.CH4O/c1-4-7-10(8-5-2)9(11)12-6-3;1-2/h4-5H,1-2,6-8H2,3H3;2H,1H3 |
| InChIKey | CWQKXBQRWRRVAG-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl N,N-bis(prop-2-enyl)carbamate;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N,N-bis(prop-2-enyl)carbamate;methanol?
The IUPAC name of ethyl N,N-bis(prop-2-enyl)carbamate;methanol (CID 88770408) is ethyl N,N-bis(prop-2-enyl)carbamate;methanol.
What is the SMILES notation for ethyl N,N-bis(prop-2-enyl)carbamate;methanol?
The canonical SMILES for ethyl N,N-bis(prop-2-enyl)carbamate;methanol is C=CCN(CC=C)C(=O)OCC.CO.
What is the InChIKey of ethyl N,N-bis(prop-2-enyl)carbamate;methanol?
The InChIKey is CWQKXBQRWRRVAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO2.CH4O/c1-4-7-10(8-5-2)9(11)12-6-3;1-2/h4-5H,1-2,6-8H2,3H3;2H,1H3.
What are the key properties of ethyl N,N-bis(prop-2-enyl)carbamate;methanol?
ethyl N,N-bis(prop-2-enyl)carbamate;methanol has a molecular weight of 201.27 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N,N-bis(prop-2-enyl)carbamate;methanol is sourced from PubChem (CID 88770408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).