C16H16ClFN+ — CID 8877070
2-[(2-chloro-6-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium (PubChem CID 8877070) has the molecular formula C16H16ClFN+ and a molecular weight of 276.76 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium |
|---|---|
| PubChem CID | 8877070 |
| Molecular Formula | C16H16ClFN+ |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl]-5,6,7,8-tetrahydroisoquinolin-2-ium |
| SMILES | Fc1cccc(Cl)c1C[n+]1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H16ClFN/c17-15-6-3-7-16(18)14(15)11-19-9-8-12-4-1-2-5-13(12)10-19/h3,6-10H,1-2,4-5,11H2/q+1 |
| InChIKey | VQGXMGXQPRXYTE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|