About 3,4-diethyl-2H-pyridin-2-ide;nickel
3,4-diethyl-2H-pyridin-2-ide;nickel (PubChem CID 88771141) has the molecular formula C9H12NNi-
and a molecular weight of 192.90 g/mol. Its IUPAC name is 3,4-diethyl-2H-pyridin-2-ide;nickel.
Molecular Properties
| Compound Name | 3,4-diethyl-2H-pyridin-2-ide;nickel |
| PubChem CID | 88771141 |
| Molecular Formula | C9H12NNi- |
| Molecular Weight | 192.90 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 3,4-diethyl-2H-pyridin-2-ide;nickel |
| SMILES | CCc1[c-]nccc1CC.[Ni] |
| InChI | InChI=1S/C9H12N.Ni/c1-3-8-5-6-10-7-9(8)4-2;/h5-6H,3-4H2,1-2H3;/q-1; |
| InChIKey | ONPHVXUDZAUCMW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.90 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethyl-2H-pyridin-2-ide;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyl-2H-pyridin-2-ide;nickel?
The IUPAC name of 3,4-diethyl-2H-pyridin-2-ide;nickel (CID 88771141) is 3,4-diethyl-2H-pyridin-2-ide;nickel.
What is the SMILES notation for 3,4-diethyl-2H-pyridin-2-ide;nickel?
The canonical SMILES for 3,4-diethyl-2H-pyridin-2-ide;nickel is CCc1[c-]nccc1CC.[Ni].
What is the InChIKey of 3,4-diethyl-2H-pyridin-2-ide;nickel?
The InChIKey is ONPHVXUDZAUCMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N.Ni/c1-3-8-5-6-10-7-9(8)4-2;/h5-6H,3-4H2,1-2H3;/q-1;.
What are the key properties of 3,4-diethyl-2H-pyridin-2-ide;nickel?
3,4-diethyl-2H-pyridin-2-ide;nickel has a molecular weight of 192.90 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyl-2H-pyridin-2-ide;nickel is sourced from PubChem (CID 88771141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).