C12H9Cl3FN3O2 — CID 88771593
1-(2-fluorophenyl)-3-methyl-5-(2,2,2-trichloroethylimino)imidazolidine-2,4-dione (PubChem CID 88771593) has the molecular formula C12H9Cl3FN3O2 and a molecular weight of 352.58 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-methyl-5-(2,2,2-trichloroethylimino)imidazolidine-2,4-dione.
| Compound Name | 1-(2-fluorophenyl)-3-methyl-5-(2,2,2-trichloroethylimino)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 88771593 |
| Molecular Formula | C12H9Cl3FN3O2 |
| Molecular Weight | 352.58 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 1-(2-fluorophenyl)-3-methyl-5-(2,2,2-trichloroethylimino)imidazolidine-2,4-dione |
| SMILES | CN1C(=O)/C(=N\CC(Cl)(Cl)Cl)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C12H9Cl3FN3O2/c1-18-10(20)9(17-6-12(13,14)15)19(11(18)21)8-5-3-2-4-7(8)16/h2-5H,6H2,1H3/b17-9+ |
| InChIKey | GVYUCSPCJGRNPS-RQZCQDPDSA-N |
| XLogP | 2.99 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|