About N-penta-1,3-dienylprop-2-enamide
N-penta-1,3-dienylprop-2-enamide (PubChem CID 88771709) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is N-penta-1,3-dienylprop-2-enamide.
Molecular Properties
| Compound Name | N-penta-1,3-dienylprop-2-enamide |
| PubChem CID | 88771709 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | N-penta-1,3-dienylprop-2-enamide |
| SMILES | C=CC(=O)NC=CC=CC |
| InChI | InChI=1S/C8H11NO/c1-3-5-6-7-9-8(10)4-2/h3-7H,2H2,1H3,(H,9,10) |
| InChIKey | DUJYBVNYDBWZBT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-penta-1,3-dienylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-penta-1,3-dienylprop-2-enamide?
The IUPAC name of N-penta-1,3-dienylprop-2-enamide (CID 88771709) is N-penta-1,3-dienylprop-2-enamide.
What is the SMILES notation for N-penta-1,3-dienylprop-2-enamide?
The canonical SMILES for N-penta-1,3-dienylprop-2-enamide is C=CC(=O)NC=CC=CC.
What is the InChIKey of N-penta-1,3-dienylprop-2-enamide?
The InChIKey is DUJYBVNYDBWZBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO/c1-3-5-6-7-9-8(10)4-2/h3-7H,2H2,1H3,(H,9,10).
What are the key properties of N-penta-1,3-dienylprop-2-enamide?
N-penta-1,3-dienylprop-2-enamide has a molecular weight of 137.18 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-penta-1,3-dienylprop-2-enamide is sourced from PubChem (CID 88771709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).