About 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione
1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione (PubChem CID 88772039) has the molecular formula C9H9N3O3
and a molecular weight of 207.19 g/mol. Its IUPAC name is 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione |
| PubChem CID | 88772039 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione |
| SMILES | CC(=O)N1CC1C#N.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C5H6N2O.C4H3NO2/c1-4(8)7-3-5(7)2-6;6-3-1-2-4(7)5-3/h5H,3H2,1H3;1-2H,(H,5,6,7) |
| InChIKey | OLWVMJMARXCQRI-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione?
The IUPAC name of 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione (CID 88772039) is 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione.
What is the SMILES notation for 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione?
The canonical SMILES for 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione is CC(=O)N1CC1C#N.O=C1C=CC(=O)N1.
What is the InChIKey of 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione?
The InChIKey is OLWVMJMARXCQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O.C4H3NO2/c1-4(8)7-3-5(7)2-6;6-3-1-2-4(7)5-3/h5H,3H2,1H3;1-2H,(H,5,6,7).
What are the key properties of 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione?
1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione has a molecular weight of 207.19 g/mol, XLogP of -1.06, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetylaziridine-2-carbonitrile;pyrrole-2,5-dione is sourced from PubChem (CID 88772039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).