C20H20N2O6S — CID 88772076
[4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)azetidin-2-yl]methyl methanesulfonate (PubChem CID 88772076) has the molecular formula C20H20N2O6S and a molecular weight of 416.46 g/mol. Its IUPAC name is [4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)azetidin-2-yl]methyl methanesulfonate.
| Compound Name | [4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)azetidin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 88772076 |
| Molecular Formula | C20H20N2O6S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [4-oxo-3-(2-oxo-4,5-diphenyl-1,3-oxazolidin-3-yl)azetidin-2-yl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCC1NC(=O)C1N1C(=O)OC(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C20H20N2O6S/c1-29(25,26)27-12-15-17(19(23)21-15)22-16(13-8-4-2-5-9-13)18(28-20(22)24)14-10-6-3-7-11-14/h2-11,15-18H,12H2,1H3,(H,21,23) |
| InChIKey | HZSPXZFVAUDDMY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|