C24H28N2O7S — CID 88772238
tert-butyl 3-[[(2S,3S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxoazetidin-3-yl]amino]-3-oxo-2-phenylpropanoate (PubChem CID 88772238) has the molecular formula C24H28N2O7S and a molecular weight of 488.56 g/mol. Its IUPAC name is tert-butyl 3-[[(2S,3S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxoazetidin-3-yl]amino]-3-oxo-2-phenylpropanoate.
| Compound Name | tert-butyl 3-[[(2S,3S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxoazetidin-3-yl]amino]-3-oxo-2-phenylpropanoate |
|---|---|
| PubChem CID | 88772238 |
| Molecular Formula | C24H28N2O7S |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | tert-butyl 3-[[(2S,3S)-2-[(4-methylphenyl)sulfonyloxymethyl]-4-oxoazetidin-3-yl]amino]-3-oxo-2-phenylpropanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2NC(=O)[C@H]2NC(=O)C(C(=O)OC(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28N2O7S/c1-15-10-12-17(13-11-15)34(30,31)32-14-18-20(22(28)25-18)26-21(27)19(16-8-6-5-7-9-16)23(29)33-24(2,3)4/h5-13,18-20H,14H2,1-4H3,(H,25,28)(H,26,27)/t18-,19?,20+/m1/s1 |
| InChIKey | GLFDVXUKXLQNIN-ITIDOPETSA-N |
| XLogP | 1.81 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|