About 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal
3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal (PubChem CID 88772555) has the molecular formula C15H26O3
and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal.
Molecular Properties
| Compound Name | 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal |
| PubChem CID | 88772555 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal |
| SMILES | CCCCCCC=C[C@@H]1OCOC[C@H]1CCC=O |
| InChI | InChI=1S/C15H26O3/c1-2-3-4-5-6-7-10-15-14(9-8-11-16)12-17-13-18-15/h7,10-11,14-15H,2-6,8-9,12-13H2,1H3/t14-,15+/m1/s1 |
| InChIKey | GIYDPURVRAJUQT-CABCVRRESA-N |
| XLogP | 3.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal?
The IUPAC name of 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal (CID 88772555) is 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal.
What is the SMILES notation for 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal?
The canonical SMILES for 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal is CCCCCCC=C[C@@H]1OCOC[C@H]1CCC=O.
What is the InChIKey of 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal?
The InChIKey is GIYDPURVRAJUQT-CABCVRRESA-N. The full InChI is InChI=1S/C15H26O3/c1-2-3-4-5-6-7-10-15-14(9-8-11-16)12-17-13-18-15/h7,10-11,14-15H,2-6,8-9,12-13H2,1H3/t14-,15+/m1/s1.
What are the key properties of 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal?
3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal has a molecular weight of 254.37 g/mol, XLogP of 3.48, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4S,5R)-4-oct-1-enyl-1,3-dioxan-5-yl]propanal is sourced from PubChem (CID 88772555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).